About aminothiourea;phenyl carbamate
aminothiourea;phenyl carbamate (PubChem CID 174929265) has the molecular formula C8H12N4O2S
and a molecular weight of 228.28 g/mol. Its IUPAC name is aminothiourea;phenyl carbamate.
Molecular Properties
| Compound Name | aminothiourea;phenyl carbamate |
| PubChem CID | 174929265 |
| Molecular Formula | C8H12N4O2S |
| Molecular Weight | 228.28 g/mol |
| Exact Mass | 228.07 |
| IUPAC Name | aminothiourea;phenyl carbamate |
| SMILES | NC(=O)Oc1ccccc1.NNC(N)=S |
| InChI | InChI=1S/C7H7NO2.CH5N3S/c8-7(9)10-6-4-2-1-3-5-6;2-1(5)4-3/h1-5H,(H2,8,9);3H2,(H3,2,4,5) |
| InChIKey | LEDFWZWULICHEF-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 116.39 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.28 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze aminothiourea;phenyl carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aminothiourea;phenyl carbamate?
The IUPAC name of aminothiourea;phenyl carbamate (CID 174929265) is aminothiourea;phenyl carbamate.
What is the SMILES notation for aminothiourea;phenyl carbamate?
The canonical SMILES for aminothiourea;phenyl carbamate is NC(=O)Oc1ccccc1.NNC(N)=S.
What is the InChIKey of aminothiourea;phenyl carbamate?
The InChIKey is LEDFWZWULICHEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NO2.CH5N3S/c8-7(9)10-6-4-2-1-3-5-6;2-1(5)4-3/h1-5H,(H2,8,9);3H2,(H3,2,4,5).
What are the key properties of aminothiourea;phenyl carbamate?
aminothiourea;phenyl carbamate has a molecular weight of 228.28 g/mol, XLogP of -0.16, 1 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for aminothiourea;phenyl carbamate is sourced from PubChem (CID 174929265), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).