About azane;carbamoyl phenyl carbonate
azane;carbamoyl phenyl carbonate (PubChem CID 175328775) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is azane;carbamoyl phenyl carbonate.
Molecular Properties
| Compound Name | azane;carbamoyl phenyl carbonate |
| PubChem CID | 175328775 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | azane;carbamoyl phenyl carbonate |
| SMILES | N.NC(=O)OC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C8H7NO4.H3N/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;/h1-5H,(H2,9,10);1H3 |
| InChIKey | WFECUUBDHHLKGY-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 113.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'} |
|---|
Analyze azane;carbamoyl phenyl carbonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;carbamoyl phenyl carbonate?
The IUPAC name of azane;carbamoyl phenyl carbonate (CID 175328775) is azane;carbamoyl phenyl carbonate.
What is the SMILES notation for azane;carbamoyl phenyl carbonate?
The canonical SMILES for azane;carbamoyl phenyl carbonate is N.NC(=O)OC(=O)Oc1ccccc1.
What is the InChIKey of azane;carbamoyl phenyl carbonate?
The InChIKey is WFECUUBDHHLKGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NO4.H3N/c9-7(10)13-8(11)12-6-4-2-1-3-5-6;/h1-5H,(H2,9,10);1H3.
What are the key properties of azane;carbamoyl phenyl carbonate?
azane;carbamoyl phenyl carbonate has a molecular weight of 198.18 g/mol, XLogP of 1.44, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for azane;carbamoyl phenyl carbonate is sourced from PubChem (CID 175328775), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).