About O-phenoxycarbonyl chloromethanethioate
O-phenoxycarbonyl chloromethanethioate (PubChem CID 150306756) has the molecular formula C8H5ClO3S
and a molecular weight of 216.65 g/mol. Its IUPAC name is O-phenoxycarbonyl chloromethanethioate.
Molecular Properties
| Compound Name | O-phenoxycarbonyl chloromethanethioate |
| PubChem CID | 150306756 |
| Molecular Formula | C8H5ClO3S |
| Molecular Weight | 216.65 g/mol |
| Exact Mass | 215.96 |
| IUPAC Name | O-phenoxycarbonyl chloromethanethioate |
| SMILES | O=C(OC(=S)Cl)Oc1ccccc1 |
| InChI | InChI=1S/C8H5ClO3S/c9-7(13)12-8(10)11-6-4-2-1-3-5-6/h1-5H |
| InChIKey | GKTLNRZYWACUPZ-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.65 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phenyl_carbonate', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-phenoxycarbonyl chloromethanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-phenoxycarbonyl chloromethanethioate?
The IUPAC name of O-phenoxycarbonyl chloromethanethioate (CID 150306756) is O-phenoxycarbonyl chloromethanethioate.
What is the SMILES notation for O-phenoxycarbonyl chloromethanethioate?
The canonical SMILES for O-phenoxycarbonyl chloromethanethioate is O=C(OC(=S)Cl)Oc1ccccc1.
What is the InChIKey of O-phenoxycarbonyl chloromethanethioate?
The InChIKey is GKTLNRZYWACUPZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5ClO3S/c9-7(13)12-8(10)11-6-4-2-1-3-5-6/h1-5H.
What are the key properties of O-phenoxycarbonyl chloromethanethioate?
O-phenoxycarbonyl chloromethanethioate has a molecular weight of 216.65 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-phenoxycarbonyl chloromethanethioate is sourced from PubChem (CID 150306756), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).