About O-phenyl N-(aminomethyl)carbamothioate
O-phenyl N-(aminomethyl)carbamothioate (PubChem CID 174929388) has the molecular formula C8H10N2OS
and a molecular weight of 182.25 g/mol. Its IUPAC name is O-phenyl N-(aminomethyl)carbamothioate.
Molecular Properties
| Compound Name | O-phenyl N-(aminomethyl)carbamothioate |
| PubChem CID | 174929388 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | O-phenyl N-(aminomethyl)carbamothioate |
| SMILES | NCNC(=S)Oc1ccccc1 |
| InChI | InChI=1S/C8H10N2OS/c9-6-10-8(12)11-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,12) |
| InChIKey | FFPMMMYIPGKKID-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-phenyl N-(aminomethyl)carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-phenyl N-(aminomethyl)carbamothioate?
The IUPAC name of O-phenyl N-(aminomethyl)carbamothioate (CID 174929388) is O-phenyl N-(aminomethyl)carbamothioate.
What is the SMILES notation for O-phenyl N-(aminomethyl)carbamothioate?
The canonical SMILES for O-phenyl N-(aminomethyl)carbamothioate is NCNC(=S)Oc1ccccc1.
What is the InChIKey of O-phenyl N-(aminomethyl)carbamothioate?
The InChIKey is FFPMMMYIPGKKID-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2OS/c9-6-10-8(12)11-7-4-2-1-3-5-7/h1-5H,6,9H2,(H,10,12).
What are the key properties of O-phenyl N-(aminomethyl)carbamothioate?
O-phenyl N-(aminomethyl)carbamothioate has a molecular weight of 182.25 g/mol, XLogP of 0.86, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for O-phenyl N-(aminomethyl)carbamothioate is sourced from PubChem (CID 174929388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).