About 3-oxo-3-phenoxypropanoic acid
3-oxo-3-phenoxypropanoic acid (PubChem CID 3015801) has the molecular formula C9H8O4
and a molecular weight of 180.16 g/mol. Its IUPAC name is 3-oxo-3-phenoxypropanoic acid.
Molecular Properties
| Compound Name | 3-oxo-3-phenoxypropanoic acid |
| PubChem CID | 3015801 |
| Molecular Formula | C9H8O4 |
| Molecular Weight | 180.16 g/mol |
| Exact Mass | 180.04 |
| IUPAC Name | 3-oxo-3-phenoxypropanoic acid |
| SMILES | O=C(O)CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C9H8O4/c10-8(11)6-9(12)13-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11) |
| InChIKey | FQCRIFDLUQGBHF-UHFFFAOYSA-N |
| XLogP | 1.07 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 180.16 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze 3-oxo-3-phenoxypropanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-3-phenoxypropanoic acid?
The IUPAC name of 3-oxo-3-phenoxypropanoic acid (CID 3015801) is 3-oxo-3-phenoxypropanoic acid.
What is the SMILES notation for 3-oxo-3-phenoxypropanoic acid?
The canonical SMILES for 3-oxo-3-phenoxypropanoic acid is O=C(O)CC(=O)Oc1ccccc1.
What is the InChIKey of 3-oxo-3-phenoxypropanoic acid?
The InChIKey is FQCRIFDLUQGBHF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O4/c10-8(11)6-9(12)13-7-4-2-1-3-5-7/h1-5H,6H2,(H,10,11).
What are the key properties of 3-oxo-3-phenoxypropanoic acid?
3-oxo-3-phenoxypropanoic acid has a molecular weight of 180.16 g/mol, XLogP of 1.07, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-3-phenoxypropanoic acid is sourced from PubChem (CID 3015801), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).