About phenyl 3-oxo-4-phenoxybutanoate;hydrochloride
phenyl 3-oxo-4-phenoxybutanoate;hydrochloride (PubChem CID 172718464) has the molecular formula C16H15ClO4
and a molecular weight of 306.75 g/mol. Its IUPAC name is phenyl 3-oxo-4-phenoxybutanoate;hydrochloride.
Molecular Properties
| Compound Name | phenyl 3-oxo-4-phenoxybutanoate;hydrochloride |
| PubChem CID | 172718464 |
| Molecular Formula | C16H15ClO4 |
| Molecular Weight | 306.75 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | phenyl 3-oxo-4-phenoxybutanoate;hydrochloride |
| SMILES | Cl.O=C(COc1ccccc1)CC(=O)Oc1ccccc1 |
| InChI | InChI=1S/C16H14O4.ClH/c17-13(12-19-14-7-3-1-4-8-14)11-16(18)20-15-9-5-2-6-10-15;/h1-10H,11-12H2;1H |
| InChIKey | GEHOCSQQZBKAFQ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 306.75 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze phenyl 3-oxo-4-phenoxybutanoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phenyl 3-oxo-4-phenoxybutanoate;hydrochloride?
The IUPAC name of phenyl 3-oxo-4-phenoxybutanoate;hydrochloride (CID 172718464) is phenyl 3-oxo-4-phenoxybutanoate;hydrochloride.
What is the SMILES notation for phenyl 3-oxo-4-phenoxybutanoate;hydrochloride?
The canonical SMILES for phenyl 3-oxo-4-phenoxybutanoate;hydrochloride is Cl.O=C(COc1ccccc1)CC(=O)Oc1ccccc1.
What is the InChIKey of phenyl 3-oxo-4-phenoxybutanoate;hydrochloride?
The InChIKey is GEHOCSQQZBKAFQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H14O4.ClH/c17-13(12-19-14-7-3-1-4-8-14)11-16(18)20-15-9-5-2-6-10-15;/h1-10H,11-12H2;1H.
What are the key properties of phenyl 3-oxo-4-phenoxybutanoate;hydrochloride?
phenyl 3-oxo-4-phenoxybutanoate;hydrochloride has a molecular weight of 306.75 g/mol, XLogP of 3.05, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for phenyl 3-oxo-4-phenoxybutanoate;hydrochloride is sourced from PubChem (CID 172718464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).