About 1-phenoxypent-4-en-2-one
1-phenoxypent-4-en-2-one (PubChem CID 62716371) has the molecular formula C11H12O2
and a molecular weight of 176.21 g/mol. Its IUPAC name is 1-phenoxypent-4-en-2-one.
Molecular Properties
| Compound Name | 1-phenoxypent-4-en-2-one |
| PubChem CID | 62716371 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.21 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-phenoxypent-4-en-2-one |
| SMILES | C=CCC(=O)COc1ccccc1 |
| InChI | InChI=1S/C11H12O2/c1-2-6-10(12)9-13-11-7-4-3-5-8-11/h2-5,7-8H,1,6,9H2 |
| InChIKey | XODAMCMTNXTQII-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.21 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-phenoxypent-4-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-phenoxypent-4-en-2-one?
The IUPAC name of 1-phenoxypent-4-en-2-one (CID 62716371) is 1-phenoxypent-4-en-2-one.
What is the SMILES notation for 1-phenoxypent-4-en-2-one?
The canonical SMILES for 1-phenoxypent-4-en-2-one is C=CCC(=O)COc1ccccc1.
What is the InChIKey of 1-phenoxypent-4-en-2-one?
The InChIKey is XODAMCMTNXTQII-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-2-6-10(12)9-13-11-7-4-3-5-8-11/h2-5,7-8H,1,6,9H2.
What are the key properties of 1-phenoxypent-4-en-2-one?
1-phenoxypent-4-en-2-one has a molecular weight of 176.21 g/mol, XLogP of 2.21, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-phenoxypent-4-en-2-one is sourced from PubChem (CID 62716371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).