About phosphoric acid;prop-2-enoxybenzene
phosphoric acid;prop-2-enoxybenzene (PubChem CID 66665136) has the molecular formula C9H13O5P
and a molecular weight of 232.17 g/mol. Its IUPAC name is phosphoric acid;prop-2-enoxybenzene.
Molecular Properties
| Compound Name | phosphoric acid;prop-2-enoxybenzene |
| PubChem CID | 66665136 |
| Molecular Formula | C9H13O5P |
| Molecular Weight | 232.17 g/mol |
| Exact Mass | 232.05 |
| IUPAC Name | phosphoric acid;prop-2-enoxybenzene |
| SMILES | C=CCOc1ccccc1.O=P(O)(O)O |
| InChI | InChI=1S/C9H10O.H3O4P/c1-2-8-10-9-6-4-3-5-7-9;1-5(2,3)4/h2-7H,1,8H2;(H3,1,2,3,4) |
| InChIKey | JXDYDLGXORIRGR-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.17 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze phosphoric acid;prop-2-enoxybenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phosphoric acid;prop-2-enoxybenzene?
The IUPAC name of phosphoric acid;prop-2-enoxybenzene (CID 66665136) is phosphoric acid;prop-2-enoxybenzene.
What is the SMILES notation for phosphoric acid;prop-2-enoxybenzene?
The canonical SMILES for phosphoric acid;prop-2-enoxybenzene is C=CCOc1ccccc1.O=P(O)(O)O.
What is the InChIKey of phosphoric acid;prop-2-enoxybenzene?
The InChIKey is JXDYDLGXORIRGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10O.H3O4P/c1-2-8-10-9-6-4-3-5-7-9;1-5(2,3)4/h2-7H,1,8H2;(H3,1,2,3,4).
What are the key properties of phosphoric acid;prop-2-enoxybenzene?
phosphoric acid;prop-2-enoxybenzene has a molecular weight of 232.17 g/mol, XLogP of 1.32, 3 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for phosphoric acid;prop-2-enoxybenzene is sourced from PubChem (CID 66665136), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).