About sodium;prop-2-enoxybenzene;2-sulfoacetate
sodium;prop-2-enoxybenzene;2-sulfoacetate (PubChem CID 134278126) has the molecular formula C11H13NaO6S
and a molecular weight of 296.28 g/mol. Its IUPAC name is sodium;prop-2-enoxybenzene;2-sulfoacetate.
Molecular Properties
| Compound Name | sodium;prop-2-enoxybenzene;2-sulfoacetate |
| PubChem CID | 134278126 |
| Molecular Formula | C11H13NaO6S |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.03 |
| IUPAC Name | sodium;prop-2-enoxybenzene;2-sulfoacetate |
| SMILES | C=CCOc1ccccc1.O=C([O-])CS(=O)(=O)O.[Na+] |
| InChI | InChI=1S/C9H10O.C2H4O5S.Na/c1-2-8-10-9-6-4-3-5-7-9;3-2(4)1-8(5,6)7;/h2-7H,1,8H2;1H2,(H,3,4)(H,5,6,7);/q;;+1/p-1 |
| InChIKey | QTPNBTCPWMTIFZ-UHFFFAOYSA-M |
| XLogP | -3.12 |
| TPSA | 103.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;prop-2-enoxybenzene;2-sulfoacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;prop-2-enoxybenzene;2-sulfoacetate?
The IUPAC name of sodium;prop-2-enoxybenzene;2-sulfoacetate (CID 134278126) is sodium;prop-2-enoxybenzene;2-sulfoacetate.
What is the SMILES notation for sodium;prop-2-enoxybenzene;2-sulfoacetate?
The canonical SMILES for sodium;prop-2-enoxybenzene;2-sulfoacetate is C=CCOc1ccccc1.O=C([O-])CS(=O)(=O)O.[Na+].
What is the InChIKey of sodium;prop-2-enoxybenzene;2-sulfoacetate?
The InChIKey is QTPNBTCPWMTIFZ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H10O.C2H4O5S.Na/c1-2-8-10-9-6-4-3-5-7-9;3-2(4)1-8(5,6)7;/h2-7H,1,8H2;1H2,(H,3,4)(H,5,6,7);/q;;+1/p-1.
What are the key properties of sodium;prop-2-enoxybenzene;2-sulfoacetate?
sodium;prop-2-enoxybenzene;2-sulfoacetate has a molecular weight of 296.28 g/mol, XLogP of -3.12, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;prop-2-enoxybenzene;2-sulfoacetate is sourced from PubChem (CID 134278126), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).