C13H19NO3S — CID 141457908
N,N-diethyl-4-prop-2-enoxybenzenesulfonamide (PubChem CID 141457908) has the molecular formula C13H19NO3S and a molecular weight of 269.37 g/mol. Its IUPAC name is N,N-diethyl-4-prop-2-enoxybenzenesulfonamide.
| Compound Name | N,N-diethyl-4-prop-2-enoxybenzenesulfonamide |
|---|---|
| PubChem CID | 141457908 |
| Molecular Formula | C13H19NO3S |
| Molecular Weight | 269.37 g/mol |
| Exact Mass | 269.11 |
| IUPAC Name | N,N-diethyl-4-prop-2-enoxybenzenesulfonamide |
| SMILES | C=CCOc1ccc(S(=O)(=O)N(CC)CC)cc1 |
| InChI | InChI=1S/C13H19NO3S/c1-4-11-17-12-7-9-13(10-8-12)18(15,16)14(5-2)6-3/h4,7-10H,1,5-6,11H2,2-3H3 |
| InChIKey | RJUJAKVIACMNLI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.37 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|