C17H18F3NO5S2 — CID 13078532
N,N-diethyl-4-[4-(trifluoromethylsulfonyl)phenoxy]benzenesulfonamide (PubChem CID 13078532) has the molecular formula C17H18F3NO5S2 and a molecular weight of 437.46 g/mol. Its IUPAC name is N,N-diethyl-4-[4-(trifluoromethylsulfonyl)phenoxy]benzenesulfonamide.
| Compound Name | N,N-diethyl-4-[4-(trifluoromethylsulfonyl)phenoxy]benzenesulfonamide |
|---|---|
| PubChem CID | 13078532 |
| Molecular Formula | C17H18F3NO5S2 |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 437.06 |
| IUPAC Name | N,N-diethyl-4-[4-(trifluoromethylsulfonyl)phenoxy]benzenesulfonamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(Oc2ccc(S(=O)(=O)C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C17H18F3NO5S2/c1-3-21(4-2)28(24,25)16-11-7-14(8-12-16)26-13-5-9-15(10-6-13)27(22,23)17(18,19)20/h5-12H,3-4H2,1-2H3 |
| InChIKey | IQQWXSSRNDMBRC-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |