C17H14F5NO4S — CID 19096174
(2,3,4,5,6-pentafluorophenyl) 4-(diethylsulfamoyl)benzoate (PubChem CID 19096174) has the molecular formula C17H14F5NO4S and a molecular weight of 423.36 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(diethylsulfamoyl)benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(diethylsulfamoyl)benzoate |
|---|---|
| PubChem CID | 19096174 |
| Molecular Formula | C17H14F5NO4S |
| Molecular Weight | 423.36 g/mol |
| Exact Mass | 423.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(diethylsulfamoyl)benzoate |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C17H14F5NO4S/c1-3-23(4-2)28(25,26)10-7-5-9(6-8-10)17(24)27-16-14(21)12(19)11(18)13(20)15(16)22/h5-8H,3-4H2,1-2H3 |
| InChIKey | OEKULFPCZSAUDZ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|