C13H4F5N3O4S — CID 77078459
(2,3,4,5,6-pentafluorophenyl) 4-azidosulfonylbenzoate (PubChem CID 77078459) has the molecular formula C13H4F5N3O4S and a molecular weight of 393.25 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-azidosulfonylbenzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-azidosulfonylbenzoate |
|---|---|
| PubChem CID | 77078459 |
| Molecular Formula | C13H4F5N3O4S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 392.98 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-azidosulfonylbenzoate |
| SMILES | [N-]=[N+]=NS(=O)(=O)c1ccc(C(=O)Oc2c(F)c(F)c(F)c(F)c2F)cc1 |
| InChI | InChI=1S/C13H4F5N3O4S/c14-7-8(15)10(17)12(11(18)9(7)16)25-13(22)5-1-3-6(4-2-5)26(23,24)21-20-19/h1-4H |
| InChIKey | CMKZHNRDAKTESB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 109.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|