C14H6BrF5O2 — CID 86091811
(2,3,4,5,6-pentafluorophenyl) 4-(bromomethyl)benzoate (PubChem CID 86091811) has the molecular formula C14H6BrF5O2 and a molecular weight of 381.09 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 4-(bromomethyl)benzoate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 4-(bromomethyl)benzoate |
|---|---|
| PubChem CID | 86091811 |
| Molecular Formula | C14H6BrF5O2 |
| Molecular Weight | 381.09 g/mol |
| Exact Mass | 379.95 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 4-(bromomethyl)benzoate |
| SMILES | O=C(Oc1c(F)c(F)c(F)c(F)c1F)c1ccc(CBr)cc1 |
| InChI | InChI=1S/C14H6BrF5O2/c15-5-6-1-3-7(4-2-6)14(21)22-13-11(19)9(17)8(16)10(18)12(13)20/h1-4H,5H2 |
| InChIKey | XDLJOYHUQWPLSN-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.09 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|