About methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate
methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate (PubChem CID 70071463) has the molecular formula C20H24BrNO4
and a molecular weight of 422.32 g/mol. Its IUPAC name is methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate.
Molecular Properties
| Compound Name | methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate |
| PubChem CID | 70071463 |
| Molecular Formula | C20H24BrNO4 |
| Molecular Weight | 422.32 g/mol |
| Exact Mass | 421.09 |
| IUPAC Name | methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate |
| SMILES | COC(=O)c1ccc(CBr)cc1.COC(=O)c1ccc(CN(C)C)cc1 |
| InChI | InChI=1S/C11H15NO2.C9H9BrO2/c1-12(2)8-9-4-6-10(7-5-9)11(13)14-3;1-12-9(11)8-4-2-7(6-10)3-5-8/h4-7H,8H2,1-3H3;2-5H,6H2,1H3 |
| InChIKey | PKRFCIIQPFHPIA-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate?
The IUPAC name of methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate (CID 70071463) is methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate.
What is the SMILES notation for methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate?
The canonical SMILES for methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate is COC(=O)c1ccc(CBr)cc1.COC(=O)c1ccc(CN(C)C)cc1.
What is the InChIKey of methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate?
The InChIKey is PKRFCIIQPFHPIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15NO2.C9H9BrO2/c1-12(2)8-9-4-6-10(7-5-9)11(13)14-3;1-12-9(11)8-4-2-7(6-10)3-5-8/h4-7H,8H2,1-3H3;2-5H,6H2,1H3.
What are the key properties of methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate?
methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate has a molecular weight of 422.32 g/mol, XLogP of 3.90, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-(bromomethyl)benzoate;methyl 4-[(dimethylamino)methyl]benzoate is sourced from PubChem (CID 70071463), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).