C19H23N3O3 — CID 47039872
methyl 4-[[4-[(dimethylamino)methyl]phenyl]methylcarbamoylamino]benzoate (PubChem CID 47039872) has the molecular formula C19H23N3O3 and a molecular weight of 341.41 g/mol. Its IUPAC name is methyl 4-[[4-[(dimethylamino)methyl]phenyl]methylcarbamoylamino]benzoate.
| Compound Name | methyl 4-[[4-[(dimethylamino)methyl]phenyl]methylcarbamoylamino]benzoate |
|---|---|
| PubChem CID | 47039872 |
| Molecular Formula | C19H23N3O3 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | methyl 4-[[4-[(dimethylamino)methyl]phenyl]methylcarbamoylamino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)NCc2ccc(CN(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H23N3O3/c1-22(2)13-15-6-4-14(5-7-15)12-20-19(24)21-17-10-8-16(9-11-17)18(23)25-3/h4-11H,12-13H2,1-3H3,(H2,20,21,24) |
| InChIKey | SSDXSFMDZUXNAH-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |