C22H29N3O3 — CID 34673655
methyl 4-[[[4-(diethylaminomethyl)phenyl]methylcarbamoylamino]methyl]benzoate (PubChem CID 34673655) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is methyl 4-[[[4-(diethylaminomethyl)phenyl]methylcarbamoylamino]methyl]benzoate.
| Compound Name | methyl 4-[[[4-(diethylaminomethyl)phenyl]methylcarbamoylamino]methyl]benzoate |
|---|---|
| PubChem CID | 34673655 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | methyl 4-[[[4-(diethylaminomethyl)phenyl]methylcarbamoylamino]methyl]benzoate |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)NCc2ccc(C(=O)OC)cc2)cc1 |
| InChI | InChI=1S/C22H29N3O3/c1-4-25(5-2)16-19-8-6-17(7-9-19)14-23-22(27)24-15-18-10-12-20(13-11-18)21(26)28-3/h6-13H,4-5,14-16H2,1-3H3,(H2,23,24,27) |
| InChIKey | SGRXSQAECXSCQN-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |