C21H29N3O — CID 24550915
N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(dimethylamino)benzamide (PubChem CID 24550915) has the molecular formula C21H29N3O and a molecular weight of 339.48 g/mol. Its IUPAC name is N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(dimethylamino)benzamide.
| Compound Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(dimethylamino)benzamide |
|---|---|
| PubChem CID | 24550915 |
| Molecular Formula | C21H29N3O |
| Molecular Weight | 339.48 g/mol |
| Exact Mass | 339.23 |
| IUPAC Name | N-[[4-(diethylaminomethyl)phenyl]methyl]-4-(dimethylamino)benzamide |
| SMILES | CCN(CC)Cc1ccc(CNC(=O)c2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C21H29N3O/c1-5-24(6-2)16-18-9-7-17(8-10-18)15-22-21(25)19-11-13-20(14-12-19)23(3)4/h7-14H,5-6,15-16H2,1-4H3,(H,22,25) |
| InChIKey | IUCVFMSNVURTKB-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.48 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |