C20H24N4O4 — CID 47033100
methyl 2-[[4-[[4-(dimethylamino)phenyl]methylcarbamoylamino]benzoyl]amino]acetate (PubChem CID 47033100) has the molecular formula C20H24N4O4 and a molecular weight of 384.44 g/mol. Its IUPAC name is methyl 2-[[4-[[4-(dimethylamino)phenyl]methylcarbamoylamino]benzoyl]amino]acetate.
| Compound Name | methyl 2-[[4-[[4-(dimethylamino)phenyl]methylcarbamoylamino]benzoyl]amino]acetate |
|---|---|
| PubChem CID | 47033100 |
| Molecular Formula | C20H24N4O4 |
| Molecular Weight | 384.44 g/mol |
| Exact Mass | 384.18 |
| IUPAC Name | methyl 2-[[4-[[4-(dimethylamino)phenyl]methylcarbamoylamino]benzoyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccc(NC(=O)NCc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C20H24N4O4/c1-24(2)17-10-4-14(5-11-17)12-22-20(27)23-16-8-6-15(7-9-16)19(26)21-13-18(25)28-3/h4-11H,12-13H2,1-3H3,(H,21,26)(H2,22,23,27) |
| InChIKey | FLNHUEMMWGPYEC-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.44 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|