C19H24N6O2 — CID 22713567
2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]acetamide (PubChem CID 22713567) has the molecular formula C19H24N6O2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]acetamide.
| Compound Name | 2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
|---|---|
| PubChem CID | 22713567 |
| Molecular Formula | C19H24N6O2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.20 |
| IUPAC Name | 2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]acetamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)NCC(=O)NCc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C19H24N6O2/c1-25(2)16-9-3-13(4-10-16)11-22-17(26)12-23-19(27)24-15-7-5-14(6-8-15)18(20)21/h3-10H,11-12H2,1-2H3,(H3,20,21)(H,22,26)(H2,23,24,27) |
| InChIKey | DHLWVZIHLVZPDF-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|