C26H30N6O2 — CID 15521687
2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]-3-phenylpropanamide (PubChem CID 15521687) has the molecular formula C26H30N6O2 and a molecular weight of 458.57 g/mol. Its IUPAC name is 2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]-3-phenylpropanamide.
| Compound Name | 2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]-3-phenylpropanamide |
|---|---|
| PubChem CID | 15521687 |
| Molecular Formula | C26H30N6O2 |
| Molecular Weight | 458.57 g/mol |
| Exact Mass | 458.24 |
| IUPAC Name | 2-[(4-carbamimidoylphenyl)carbamoylamino]-N-[[4-(dimethylamino)phenyl]methyl]-3-phenylpropanamide |
| SMILES | [H]/N=C(\N)c1ccc(NC(=O)NC(Cc2ccccc2)C(=O)NCc2ccc(N(C)C)cc2)cc1 |
| InChI | InChI=1S/C26H30N6O2/c1-32(2)22-14-8-19(9-15-22)17-29-25(33)23(16-18-6-4-3-5-7-18)31-26(34)30-21-12-10-20(11-13-21)24(27)28/h3-15,23H,16-17H2,1-2H3,(H3,27,28)(H,29,33)(H2,30,31,34) |
| InChIKey | ZAYODXWDAFOKRU-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 123.34 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.57 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|