C24H26N6O3S — CID 71449612
(2R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(4-carbamimidoylphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 71449612) has the molecular formula C24H26N6O3S and a molecular weight of 478.58 g/mol. Its IUPAC name is (2R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(4-carbamimidoylphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | (2R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(4-carbamimidoylphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 71449612 |
| Molecular Formula | C24H26N6O3S |
| Molecular Weight | 478.58 g/mol |
| Exact Mass | 478.18 |
| IUPAC Name | (2R)-N-[(4-carbamimidoylphenyl)methyl]-2-[(4-carbamimidoylphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | [H]/N=C(\N)c1ccc(CNC(=O)[C@@H](Cc2ccccc2)NS(=O)(=O)c2ccc(/C(N)=N/[H])cc2)cc1 |
| InChI | InChI=1S/C24H26N6O3S/c25-22(26)18-8-6-17(7-9-18)15-29-24(31)21(14-16-4-2-1-3-5-16)30-34(32,33)20-12-10-19(11-13-20)23(27)28/h1-13,21,30H,14-15H2,(H3,25,26)(H3,27,28)(H,29,31)/t21-/m1/s1 |
| InChIKey | SAQHGQBWDVZZFQ-OAQYLSRUSA-N |
| XLogP | 1.46 |
| TPSA | 175.01 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|