C23H21N3O6S — CID 22456314
2-[[4-(4-carbamimidoylphenoxy)carbonylphenyl]sulfonylamino]-3-phenylpropanoic acid (PubChem CID 22456314) has the molecular formula C23H21N3O6S and a molecular weight of 467.50 g/mol. Its IUPAC name is 2-[[4-(4-carbamimidoylphenoxy)carbonylphenyl]sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | 2-[[4-(4-carbamimidoylphenoxy)carbonylphenyl]sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 22456314 |
| Molecular Formula | C23H21N3O6S |
| Molecular Weight | 467.50 g/mol |
| Exact Mass | 467.12 |
| IUPAC Name | 2-[[4-(4-carbamimidoylphenoxy)carbonylphenyl]sulfonylamino]-3-phenylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(S(=O)(=O)NC(Cc3ccccc3)C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C23H21N3O6S/c24-21(25)16-6-10-18(11-7-16)32-23(29)17-8-12-19(13-9-17)33(30,31)26-20(22(27)28)14-15-4-2-1-3-5-15/h1-13,20,26H,14H2,(H3,24,25)(H,27,28) |
| InChIKey | LTEAFPKPGSTSAV-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 159.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.50 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|