C20H23N5O6S — CID 18794035
2-(benzenesulfonamido)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]propanoic acid (PubChem CID 18794035) has the molecular formula C20H23N5O6S and a molecular weight of 461.50 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]propanoic acid.
| Compound Name | 2-(benzenesulfonamido)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]propanoic acid |
|---|---|
| PubChem CID | 18794035 |
| Molecular Formula | C20H23N5O6S |
| Molecular Weight | 461.50 g/mol |
| Exact Mass | 461.14 |
| IUPAC Name | 2-(benzenesulfonamido)-3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCC(=O)NCC(NS(=O)(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C20H23N5O6S/c21-18(22)13-6-8-14(9-7-13)19(27)23-11-10-17(26)24-12-16(20(28)29)25-32(30,31)15-4-2-1-3-5-15/h1-9,16,25H,10-12H2,(H3,21,22)(H,23,27)(H,24,26)(H,28,29) |
| InChIKey | YTKRYZDSHGERFE-UHFFFAOYSA-N |
| XLogP | -0.36 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.50 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|