C21H22F3N5O6S — CID 18794161
3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid (PubChem CID 18794161) has the molecular formula C21H22F3N5O6S and a molecular weight of 529.50 g/mol. Its IUPAC name is 3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid.
| Compound Name | 3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 18794161 |
| Molecular Formula | C21H22F3N5O6S |
| Molecular Weight | 529.50 g/mol |
| Exact Mass | 529.12 |
| IUPAC Name | 3-[3-[(4-carbamimidoylbenzoyl)amino]propanoylamino]-2-[[2-(trifluoromethyl)phenyl]sulfonylamino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(C(=O)NCCC(=O)NCC(NS(=O)(=O)c2ccccc2C(F)(F)F)C(=O)O)cc1 |
| InChI | InChI=1S/C21H22F3N5O6S/c22-21(23,24)14-3-1-2-4-16(14)36(34,35)29-15(20(32)33)11-28-17(30)9-10-27-19(31)13-7-5-12(6-8-13)18(25)26/h1-8,15,29H,9-11H2,(H3,25,26)(H,27,31)(H,28,30)(H,32,33) |
| InChIKey | MOPNRCHDLGJZJV-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 191.54 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.50 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|