C21H26N4O7S — CID 18794162
3-[4-(4-carbamimidoylphenoxy)butanoylamino]-2-[(2-methoxyphenyl)sulfonylamino]propanoic acid (PubChem CID 18794162) has the molecular formula C21H26N4O7S and a molecular weight of 478.53 g/mol. Its IUPAC name is 3-[4-(4-carbamimidoylphenoxy)butanoylamino]-2-[(2-methoxyphenyl)sulfonylamino]propanoic acid.
| Compound Name | 3-[4-(4-carbamimidoylphenoxy)butanoylamino]-2-[(2-methoxyphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 18794162 |
| Molecular Formula | C21H26N4O7S |
| Molecular Weight | 478.53 g/mol |
| Exact Mass | 478.15 |
| IUPAC Name | 3-[4-(4-carbamimidoylphenoxy)butanoylamino]-2-[(2-methoxyphenyl)sulfonylamino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCCCC(=O)NCC(NS(=O)(=O)c2ccccc2OC)C(=O)O)cc1 |
| InChI | InChI=1S/C21H26N4O7S/c1-31-17-5-2-3-6-18(17)33(29,30)25-16(21(27)28)13-24-19(26)7-4-12-32-15-10-8-14(9-11-15)20(22)23/h2-3,5-6,8-11,16,25H,4,7,12-13H2,1H3,(H3,22,23)(H,24,26)(H,27,28) |
| InChIKey | DIMDOUYPBBDQFC-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 180.90 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.53 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|