C22H28N4O6S — CID 174370130
(2S)-2-(benzenesulfonamido)-2-[[4-(4-carbamimidoylphenoxy)butanoylamino]methyl]butanoic acid (PubChem CID 174370130) has the molecular formula C22H28N4O6S and a molecular weight of 476.56 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-2-[[4-(4-carbamimidoylphenoxy)butanoylamino]methyl]butanoic acid.
| Compound Name | (2S)-2-(benzenesulfonamido)-2-[[4-(4-carbamimidoylphenoxy)butanoylamino]methyl]butanoic acid |
|---|---|
| PubChem CID | 174370130 |
| Molecular Formula | C22H28N4O6S |
| Molecular Weight | 476.56 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-2-[[4-(4-carbamimidoylphenoxy)butanoylamino]methyl]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OCCCC(=O)NC[C@](CC)(NS(=O)(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C22H28N4O6S/c1-2-22(21(28)29,26-33(30,31)18-7-4-3-5-8-18)15-25-19(27)9-6-14-32-17-12-10-16(11-13-17)20(23)24/h3-5,7-8,10-13,26H,2,6,9,14-15H2,1H3,(H3,23,24)(H,25,27)(H,28,29)/t22-/m0/s1 |
| InChIKey | USNYIIMTOTXHEX-QFIPXVFZSA-N |
| XLogP | 1.46 |
| TPSA | 171.67 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.56 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|