C23H27N3O6S — CID 54433809
2-(benzenesulfonamido)-3-[[6-(4-ethanimidoylphenyl)-6-oxohexanoyl]amino]propanoic acid (PubChem CID 54433809) has the molecular formula C23H27N3O6S and a molecular weight of 473.55 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-[[6-(4-ethanimidoylphenyl)-6-oxohexanoyl]amino]propanoic acid.
| Compound Name | 2-(benzenesulfonamido)-3-[[6-(4-ethanimidoylphenyl)-6-oxohexanoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 54433809 |
| Molecular Formula | C23H27N3O6S |
| Molecular Weight | 473.55 g/mol |
| Exact Mass | 473.16 |
| IUPAC Name | 2-(benzenesulfonamido)-3-[[6-(4-ethanimidoylphenyl)-6-oxohexanoyl]amino]propanoic acid |
| SMILES | [H]/N=C(\C)c1ccc(C(=O)CCCCC(=O)NCC(NS(=O)(=O)c2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C23H27N3O6S/c1-16(24)17-11-13-18(14-12-17)21(27)9-5-6-10-22(28)25-15-20(23(29)30)26-33(31,32)19-7-3-2-4-8-19/h2-4,7-8,11-14,20,24,26H,5-6,9-10,15H2,1H3,(H,25,28)(H,29,30)/b24-16+ |
| InChIKey | WJIOSGGZHXYNAJ-LFVJCYFKSA-N |
| XLogP | 2.37 |
| TPSA | 153.49 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.55 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|