C22H26N6O7S — CID 173252202
(2S)-2-(benzenesulfonamido)-3-[[2-[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid (PubChem CID 173252202) has the molecular formula C22H26N6O7S and a molecular weight of 518.55 g/mol. Its IUPAC name is (2S)-2-(benzenesulfonamido)-3-[[2-[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid.
| Compound Name | (2S)-2-(benzenesulfonamido)-3-[[2-[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 173252202 |
| Molecular Formula | C22H26N6O7S |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.16 |
| IUPAC Name | (2S)-2-(benzenesulfonamido)-3-[[2-[4-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid |
| SMILES | N/C(=N/O)c1ccc(N2CCN(CC(=O)NC[C@H](NS(=O)(=O)c3ccccc3)C(=O)O)C(=O)C2)cc1 |
| InChI | InChI=1S/C22H26N6O7S/c23-21(25-33)15-6-8-16(9-7-15)27-10-11-28(20(30)14-27)13-19(29)24-12-18(22(31)32)26-36(34,35)17-4-2-1-3-5-17/h1-9,18,26,33H,10-14H2,(H2,23,25)(H,24,29)(H,31,32)/t18-/m0/s1 |
| InChIKey | KLCQSZJDMGFKLF-SFHVURJKSA-N |
| XLogP | -1.02 |
| TPSA | 194.73 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | -1.02 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|