C22H33N5O5 — CID 18321667
ethyl 3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-5-methylhexanoate (PubChem CID 18321667) has the molecular formula C22H33N5O5 and a molecular weight of 447.54 g/mol. Its IUPAC name is ethyl 3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-5-methylhexanoate.
| Compound Name | ethyl 3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-5-methylhexanoate |
|---|---|
| PubChem CID | 18321667 |
| Molecular Formula | C22H33N5O5 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.25 |
| IUPAC Name | ethyl 3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-5-methylhexanoate |
| SMILES | CCOC(=O)CC(CC(C)C)NC(=O)CN1CCN(c2ccc(/C(N)=N/O)cc2)CC1=O |
| InChI | InChI=1S/C22H33N5O5/c1-4-32-21(30)12-17(11-15(2)3)24-19(28)13-27-10-9-26(14-20(27)29)18-7-5-16(6-8-18)22(23)25-31/h5-8,15,17,31H,4,9-14H2,1-3H3,(H2,23,25)(H,24,28) |
| InChIKey | WLZRUQUMKQKEAL-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 137.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|