C13H23Cl3N4O — CID 139714848
4-(4-ethylpiperazin-1-yl)-N'-hydroxybenzenecarboximidamide;trihydrochloride (PubChem CID 139714848) has the molecular formula C13H23Cl3N4O and a molecular weight of 357.71 g/mol. Its IUPAC name is 4-(4-ethylpiperazin-1-yl)-N'-hydroxybenzenecarboximidamide;trihydrochloride.
| Compound Name | 4-(4-ethylpiperazin-1-yl)-N'-hydroxybenzenecarboximidamide;trihydrochloride |
|---|---|
| PubChem CID | 139714848 |
| Molecular Formula | C13H23Cl3N4O |
| Molecular Weight | 357.71 g/mol |
| Exact Mass | 356.09 |
| IUPAC Name | 4-(4-ethylpiperazin-1-yl)-N'-hydroxybenzenecarboximidamide;trihydrochloride |
| SMILES | CCN1CCN(c2ccc(C(N)=NO)cc2)CC1.Cl.Cl.Cl |
| InChI | InChI=1S/C13H20N4O.3ClH/c1-2-16-7-9-17(10-8-16)12-5-3-11(4-6-12)13(14)15-18;;;/h3-6,18H,2,7-10H2,1H3,(H2,14,15);3*1H |
| InChIKey | LVWLJHOJAFXYIF-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 65.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.71 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|