C27H42Cl2N6 — CID 15954190
N'-butyl-4-[4-[4-(N'-butylcarbamimidoyl)phenyl]-1,4-diazepan-1-yl]benzenecarboximidamide;dihydrochloride (PubChem CID 15954190) has the molecular formula C27H42Cl2N6 and a molecular weight of 521.58 g/mol. Its IUPAC name is N'-butyl-4-[4-[4-(N'-butylcarbamimidoyl)phenyl]-1,4-diazepan-1-yl]benzenecarboximidamide;dihydrochloride.
| Compound Name | N'-butyl-4-[4-[4-(N'-butylcarbamimidoyl)phenyl]-1,4-diazepan-1-yl]benzenecarboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 15954190 |
| Molecular Formula | C27H42Cl2N6 |
| Molecular Weight | 521.58 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | N'-butyl-4-[4-[4-(N'-butylcarbamimidoyl)phenyl]-1,4-diazepan-1-yl]benzenecarboximidamide;dihydrochloride |
| SMILES | CCCC/N=C(\N)c1ccc(N2CCCN(c3ccc(/C(N)=N/CCCC)cc3)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C27H40N6.2ClH/c1-3-5-16-30-26(28)22-8-12-24(13-9-22)32-18-7-19-33(21-20-32)25-14-10-23(11-15-25)27(29)31-17-6-4-2;;/h8-15H,3-7,16-21H2,1-2H3,(H2,28,30)(H2,29,31);2*1H |
| InChIKey | UWKOAFOVVUUWQV-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 83.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.58 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|