C26H29N5O8 — CID 173254561
3-(1,3-benzodioxol-5-yl)-3-[[2-[4-[4-(N-ethoxycarbonylcarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid (PubChem CID 173254561) has the molecular formula C26H29N5O8 and a molecular weight of 539.55 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-3-[[2-[4-[4-(N-ethoxycarbonylcarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-3-[[2-[4-[4-(N-ethoxycarbonylcarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 173254561 |
| Molecular Formula | C26H29N5O8 |
| Molecular Weight | 539.55 g/mol |
| Exact Mass | 539.20 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-3-[[2-[4-[4-(N-ethoxycarbonylcarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid |
| SMILES | [H]/N=C(\NC(=O)OCC)c1ccc(N2CCN(CC(=O)NC(CC(=O)O)c3ccc4c(c3)OCO4)C(=O)C2)cc1 |
| InChI | InChI=1S/C26H29N5O8/c1-2-37-26(36)29-25(27)16-3-6-18(7-4-16)30-9-10-31(23(33)14-30)13-22(32)28-19(12-24(34)35)17-5-8-20-21(11-17)39-15-38-20/h3-8,11,19H,2,9-10,12-15H2,1H3,(H,28,32)(H,34,35)(H2,27,29,36) |
| InChIKey | OYDOCNVFBNFFIB-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 170.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.55 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|