C21H29N6O7- — CID 18328841
2-(butoxycarbonylamino)-3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoate (PubChem CID 18328841) has the molecular formula C21H29N6O7- and a molecular weight of 477.50 g/mol. Its IUPAC name is 2-(butoxycarbonylamino)-3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoate.
| Compound Name | 2-(butoxycarbonylamino)-3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 18328841 |
| Molecular Formula | C21H29N6O7- |
| Molecular Weight | 477.50 g/mol |
| Exact Mass | 477.21 |
| IUPAC Name | 2-(butoxycarbonylamino)-3-[[2-[4-[4-[(Z)-N'-hydroxycarbamimidoyl]phenyl]-2-oxopiperazin-1-yl]acetyl]amino]propanoate |
| SMILES | CCCCOC(=O)NC(CNC(=O)CN1CCN(c2ccc(/C(N)=N/O)cc2)CC1=O)C(=O)[O-] |
| InChI | InChI=1S/C21H30N6O7/c1-2-3-10-34-21(32)24-16(20(30)31)11-23-17(28)12-27-9-8-26(13-18(27)29)15-6-4-14(5-7-15)19(22)25-33/h4-7,16,33H,2-3,8-13H2,1H3,(H2,22,25)(H,23,28)(H,24,32)(H,30,31)/p-1 |
| InChIKey | UZYQZAAQGMYLCV-UHFFFAOYSA-M |
| XLogP | -1.81 |
| TPSA | 189.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.50 |
| LogP ≤ 5 | -1.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|