C25H35N5O7 — CID 11466485
(2S)-2-(butoxycarbonylamino)-5-[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-5-oxopentanoic acid (PubChem CID 11466485) has the molecular formula C25H35N5O7 and a molecular weight of 517.58 g/mol. Its IUPAC name is (2S)-2-(butoxycarbonylamino)-5-[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-5-oxopentanoic acid.
| Compound Name | (2S)-2-(butoxycarbonylamino)-5-[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-5-oxopentanoic acid |
|---|---|
| PubChem CID | 11466485 |
| Molecular Formula | C25H35N5O7 |
| Molecular Weight | 517.58 g/mol |
| Exact Mass | 517.25 |
| IUPAC Name | (2S)-2-(butoxycarbonylamino)-5-[2-[4-[(E)-N'-hydroxycarbamimidoyl]phenyl]-1-oxo-2,8-diazaspiro[4.5]decan-8-yl]-5-oxopentanoic acid |
| SMILES | CCCCOC(=O)N[C@@H](CCC(=O)N1CCC2(CC1)CCN(c1ccc(/C(N)=N\O)cc1)C2=O)C(=O)O |
| InChI | InChI=1S/C25H35N5O7/c1-2-3-16-37-24(35)27-19(22(32)33)8-9-20(31)29-13-10-25(11-14-29)12-15-30(23(25)34)18-6-4-17(5-7-18)21(26)28-36/h4-7,19,36H,2-3,8-16H2,1H3,(H2,26,28)(H,27,35)(H,32,33)/t19-/m0/s1 |
| InChIKey | RZIDDQXOXRSLKT-IBGZPJMESA-N |
| XLogP | 1.89 |
| TPSA | 174.86 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.58 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|