C21H27N5O6 — CID 18328788
2-(butoxycarbonylamino)-3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid (PubChem CID 18328788) has the molecular formula C21H27N5O6 and a molecular weight of 445.48 g/mol. Its IUPAC name is 2-(butoxycarbonylamino)-3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid.
| Compound Name | 2-(butoxycarbonylamino)-3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 18328788 |
| Molecular Formula | C21H27N5O6 |
| Molecular Weight | 445.48 g/mol |
| Exact Mass | 445.20 |
| IUPAC Name | 2-(butoxycarbonylamino)-3-[[2-[4-(4-cyanophenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoic acid |
| SMILES | CCCCOC(=O)NC(CNC(=O)CN1CCN(c2ccc(C#N)cc2)CC1=O)C(=O)O |
| InChI | InChI=1S/C21H27N5O6/c1-2-3-10-32-21(31)24-17(20(29)30)12-23-18(27)13-26-9-8-25(14-19(26)28)16-6-4-15(11-22)5-7-16/h4-7,17H,2-3,8-10,12-14H2,1H3,(H,23,27)(H,24,31)(H,29,30) |
| InChIKey | MLYDXYNCMBUGJC-UHFFFAOYSA-N |
| XLogP | 0.30 |
| TPSA | 152.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.48 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|