C24H38N6O8S — CID 160939217
acetic acid;ethyl (2S)-2-(butylsulfonylamino)-3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoate (PubChem CID 160939217) has the molecular formula C24H38N6O8S and a molecular weight of 570.67 g/mol. Its IUPAC name is acetic acid;ethyl (2S)-2-(butylsulfonylamino)-3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoate.
| Compound Name | acetic acid;ethyl (2S)-2-(butylsulfonylamino)-3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoate |
|---|---|
| PubChem CID | 160939217 |
| Molecular Formula | C24H38N6O8S |
| Molecular Weight | 570.67 g/mol |
| Exact Mass | 570.25 |
| IUPAC Name | acetic acid;ethyl (2S)-2-(butylsulfonylamino)-3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]propanoate |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(N2CCN(CC(=O)NC[C@H](NS(=O)(=O)CCCC)C(=O)OCC)C(=O)C2)cc1 |
| InChI | InChI=1S/C22H34N6O6S.C2H4O2/c1-3-5-12-35(32,33)26-18(22(31)34-4-2)13-25-19(29)14-28-11-10-27(15-20(28)30)17-8-6-16(7-9-17)21(23)24;1-2(3)4/h6-9,18,26H,3-5,10-15H2,1-2H3,(H3,23,24)(H,25,29);1H3,(H,3,4)/t18-;/m0./s1 |
| InChIKey | SUGYVHOAUHMILE-FERBBOLQSA-N |
| XLogP | -0.52 |
| TPSA | 212.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.67 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|