C23H28N6O8S — CID 173256918
(2S)-3-[[2-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid (PubChem CID 173256918) has the molecular formula C23H28N6O8S and a molecular weight of 548.58 g/mol. Its IUPAC name is (2S)-3-[[2-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid.
| Compound Name | (2S)-3-[[2-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
|---|---|
| PubChem CID | 173256918 |
| Molecular Formula | C23H28N6O8S |
| Molecular Weight | 548.58 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | (2S)-3-[[2-[4-[4-(N'-hydroxycarbamimidoyl)phenyl]-2-oxopiperazin-1-yl]acetyl]amino]-2-[(4-methoxyphenyl)sulfonylamino]propanoic acid |
| SMILES | COc1ccc(S(=O)(=O)N[C@@H](CNC(=O)CN2CCN(c3ccc(C(N)=NO)cc3)CC2=O)C(=O)O)cc1 |
| InChI | InChI=1S/C23H28N6O8S/c1-37-17-6-8-18(9-7-17)38(35,36)27-19(23(32)33)12-25-20(30)13-29-11-10-28(14-21(29)31)16-4-2-15(3-5-16)22(24)26-34/h2-9,19,27,34H,10-14H2,1H3,(H2,24,26)(H,25,30)(H,32,33)/t19-/m0/s1 |
| InChIKey | ALKZNTPTWJLMPD-IBGZPJMESA-N |
| XLogP | -1.01 |
| TPSA | 203.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.58 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|