C23H28N6O6 — CID 70154204
acetic acid;3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-pyridin-2-ylpropanoic acid (PubChem CID 70154204) has the molecular formula C23H28N6O6 and a molecular weight of 484.51 g/mol. Its IUPAC name is acetic acid;3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-pyridin-2-ylpropanoic acid.
| Compound Name | acetic acid;3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-pyridin-2-ylpropanoic acid |
|---|---|
| PubChem CID | 70154204 |
| Molecular Formula | C23H28N6O6 |
| Molecular Weight | 484.51 g/mol |
| Exact Mass | 484.21 |
| IUPAC Name | acetic acid;3-[[2-[4-(4-carbamimidoylphenyl)-2-oxopiperazin-1-yl]acetyl]amino]-3-pyridin-2-ylpropanoic acid |
| SMILES | CC(=O)O.[H]/N=C(\N)c1ccc(N2CCN(CC(=O)NC(CC(=O)O)c3ccccn3)C(=O)C2)cc1 |
| InChI | InChI=1S/C21H24N6O4.C2H4O2/c22-21(23)14-4-6-15(7-5-14)26-9-10-27(19(29)13-26)12-18(28)25-17(11-20(30)31)16-3-1-2-8-24-16;1-2(3)4/h1-8,17H,9-13H2,(H3,22,23)(H,25,28)(H,30,31);1H3,(H,3,4) |
| InChIKey | WKFXSPKNBRMEEJ-UHFFFAOYSA-N |
| XLogP | 0.44 |
| TPSA | 190.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.51 |
| LogP ≤ 5 | 0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|