C23H26N4O4 — CID 54262459
3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-phenylpropanoic acid (PubChem CID 54262459) has the molecular formula C23H26N4O4 and a molecular weight of 422.49 g/mol. Its IUPAC name is 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-phenylpropanoic acid.
| Compound Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 54262459 |
| Molecular Formula | C23H26N4O4 |
| Molecular Weight | 422.49 g/mol |
| Exact Mass | 422.20 |
| IUPAC Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-phenylpropanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCCC(CC(=O)NC(CC(=O)O)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C23H26N4O4/c24-22(25)16-8-10-18(11-9-16)27-12-4-7-17(23(27)31)13-20(28)26-19(14-21(29)30)15-5-2-1-3-6-15/h1-3,5-6,8-11,17,19H,4,7,12-14H2,(H3,24,25)(H,26,28)(H,29,30) |
| InChIKey | RELQPMJKDRXEPV-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 136.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.49 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|