C26H32N4O5 — CID 70120318
3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)pentanoic acid (PubChem CID 70120318) has the molecular formula C26H32N4O5 and a molecular weight of 480.57 g/mol. Its IUPAC name is 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)pentanoic acid.
| Compound Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)pentanoic acid |
|---|---|
| PubChem CID | 70120318 |
| Molecular Formula | C26H32N4O5 |
| Molecular Weight | 480.57 g/mol |
| Exact Mass | 480.24 |
| IUPAC Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)pentanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCCC(CC(=O)NC(CC)(CC(=O)O)c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C26H32N4O5/c1-3-26(16-23(32)33,19-8-12-21(35-2)13-9-19)29-22(31)15-18-5-4-14-30(25(18)34)20-10-6-17(7-11-20)24(27)28/h6-13,18H,3-5,14-16H2,1-2H3,(H3,27,28)(H,29,31)(H,32,33) |
| InChIKey | URVJPCWTOXLZOH-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.57 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|