C24H28N4O5 — CID 70279078
3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)propanoic acid (PubChem CID 70279078) has the molecular formula C24H28N4O5 and a molecular weight of 452.51 g/mol. Its IUPAC name is 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)propanoic acid.
| Compound Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 70279078 |
| Molecular Formula | C24H28N4O5 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.21 |
| IUPAC Name | 3-[[2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]acetyl]amino]-3-(4-methoxyphenyl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCCC(CC(=O)NC(CC(=O)O)c3ccc(OC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H28N4O5/c1-33-19-10-6-15(7-11-19)20(14-22(30)31)27-21(29)13-17-3-2-12-28(24(17)32)18-8-4-16(5-9-18)23(25)26/h4-11,17,20H,2-3,12-14H2,1H3,(H3,25,26)(H,27,29)(H,30,31) |
| InChIKey | LKZBGPQZXWAYLT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 145.81 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|