C16H21N5O4 — CID 67752703
3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]butanoic acid (PubChem CID 67752703) has the molecular formula C16H21N5O4 and a molecular weight of 347.38 g/mol. Its IUPAC name is 3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]butanoic acid.
| Compound Name | 3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]butanoic acid |
|---|---|
| PubChem CID | 67752703 |
| Molecular Formula | C16H21N5O4 |
| Molecular Weight | 347.38 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]butanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(NC(=O)NC(C)CC(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C16H21N5O4/c1-9(8-13(22)23)19-16(25)20-12-6-7-21(15(12)24)11-4-2-10(3-5-11)14(17)18/h2-5,9,12H,6-8H2,1H3,(H3,17,18)(H,22,23)(H2,19,20,25) |
| InChIKey | POMWFKKYEJAZJR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 148.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.38 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|