C26H29N7O6 — CID 146365811
ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[(3-hydroxy-3H-indole-2-carbonyl)amino]propanoate (PubChem CID 146365811) has the molecular formula C26H29N7O6 and a molecular weight of 535.56 g/mol. Its IUPAC name is ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[(3-hydroxy-3H-indole-2-carbonyl)amino]propanoate.
| Compound Name | ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[(3-hydroxy-3H-indole-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 146365811 |
| Molecular Formula | C26H29N7O6 |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 535.22 |
| IUPAC Name | ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[(3-hydroxy-3H-indole-2-carbonyl)amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(NC(=O)NC[C@H](NC(=O)C3=Nc4ccccc4C3O)C(=O)OCC)C2=O)cc1 |
| InChI | InChI=1S/C26H29N7O6/c1-2-39-25(37)19(31-23(35)20-21(34)16-5-3-4-6-17(16)30-20)13-29-26(38)32-18-11-12-33(24(18)36)15-9-7-14(8-10-15)22(27)28/h3-10,18-19,21,34H,2,11-13H2,1H3,(H3,27,28)(H,31,35)(H2,29,32,38)/t18?,19-,21?/m0/s1 |
| InChIKey | VMOMRTBLEKNDKN-SCCNAQOGSA-N |
| XLogP | 0.24 |
| TPSA | 199.30 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|