C27H31N7O6 — CID 167020133
ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate (PubChem CID 167020133) has the molecular formula C27H31N7O6 and a molecular weight of 549.59 g/mol. Its IUPAC name is ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate.
| Compound Name | ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate |
|---|---|
| PubChem CID | 167020133 |
| Molecular Formula | C27H31N7O6 |
| Molecular Weight | 549.59 g/mol |
| Exact Mass | 549.23 |
| IUPAC Name | ethyl (2S)-3-[[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]carbamoylamino]-2-[[3-(hydroxymethyl)-1H-indole-2-carbonyl]amino]propanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(NC(=O)NC[C@H](NC(=O)c3[nH]c4ccccc4c3CO)C(=O)OCC)C2=O)cc1 |
| InChI | InChI=1S/C27H31N7O6/c1-2-40-26(38)21(32-24(36)22-18(14-35)17-5-3-4-6-19(17)31-22)13-30-27(39)33-20-11-12-34(25(20)37)16-9-7-15(8-10-16)23(28)29/h3-10,20-21,31,35H,2,11-14H2,1H3,(H3,28,29)(H,32,36)(H2,30,33,39)/t20?,21-/m0/s1 |
| InChIKey | KRIMUWLBYTVNJC-LBAQZLPGSA-N |
| XLogP | 0.71 |
| TPSA | 202.73 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.59 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|