C28H29N5O7S — CID 163681246
ethyl (2S)-6-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]-5-oxo-2-[(3-sulfonylindole-2-carbonyl)amino]hexanoate (PubChem CID 163681246) has the molecular formula C28H29N5O7S and a molecular weight of 579.64 g/mol. Its IUPAC name is ethyl (2S)-6-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]-5-oxo-2-[(3-sulfonylindole-2-carbonyl)amino]hexanoate.
| Compound Name | ethyl (2S)-6-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]-5-oxo-2-[(3-sulfonylindole-2-carbonyl)amino]hexanoate |
|---|---|
| PubChem CID | 163681246 |
| Molecular Formula | C28H29N5O7S |
| Molecular Weight | 579.64 g/mol |
| Exact Mass | 579.18 |
| IUPAC Name | ethyl (2S)-6-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]-5-oxo-2-[(3-sulfonylindole-2-carbonyl)amino]hexanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(CC(=O)CC[C@H](NC(=O)C3=Nc4ccccc4C3=S(=O)=O)C(=O)OCC)C2=O)cc1 |
| InChI | InChI=1S/C28H29N5O7S/c1-2-40-28(37)22(32-26(35)23-24(41(38)39)20-5-3-4-6-21(20)31-23)12-11-19(34)15-17-13-14-33(27(17)36)18-9-7-16(8-10-18)25(29)30/h3-10,17,22H,2,11-15H2,1H3,(H3,29,30)(H,32,35)/t17?,22-/m0/s1 |
| InChIKey | UDRKLBZXMUPLKW-UGNFMNBCSA-N |
| XLogP | 1.30 |
| TPSA | 189.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.64 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|