C17H22N4O4 — CID 23215189
acetyl 4-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]butanoate (PubChem CID 23215189) has the molecular formula C17H22N4O4 and a molecular weight of 346.39 g/mol. Its IUPAC name is acetyl 4-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]butanoate.
| Compound Name | acetyl 4-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]butanoate |
|---|---|
| PubChem CID | 23215189 |
| Molecular Formula | C17H22N4O4 |
| Molecular Weight | 346.39 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | acetyl 4-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopyrrolidin-3-yl]butanoate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(C(CCN)C(=O)OC(C)=O)C2=O)cc1 |
| InChI | InChI=1S/C17H22N4O4/c1-10(22)25-17(24)14(6-8-18)13-7-9-21(16(13)23)12-4-2-11(3-5-12)15(19)20/h2-5,13-14H,6-9,18H2,1H3,(H3,19,20) |
| InChIKey | BCTQFKHAFOTUGV-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 139.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.39 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|