C19H22N4O4 — CID 23215178
2-acetyl-5-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]pent-4-ynoic acid (PubChem CID 23215178) has the molecular formula C19H22N4O4 and a molecular weight of 370.41 g/mol. Its IUPAC name is 2-acetyl-5-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]pent-4-ynoic acid.
| Compound Name | 2-acetyl-5-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]pent-4-ynoic acid |
|---|---|
| PubChem CID | 23215178 |
| Molecular Formula | C19H22N4O4 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.16 |
| IUPAC Name | 2-acetyl-5-amino-2-[1-(4-carbamimidoylphenyl)-2-oxopiperidin-3-yl]pent-4-ynoic acid |
| SMILES | [H]/N=C(\N)c1ccc(N2CCCC(C(CC#CN)(C(C)=O)C(=O)O)C2=O)cc1 |
| InChI | InChI=1S/C19H22N4O4/c1-12(24)19(18(26)27,9-3-10-20)15-4-2-11-23(17(15)25)14-7-5-13(6-8-14)16(21)22/h5-8,15H,2,4,9,11,20H2,1H3,(H3,21,22)(H,26,27) |
| InChIKey | GUTPEENKXRBHCS-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 150.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|