C24H27N5O6 — CID 70247709
(3S)-3-[[2-[(4S)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(4-ethoxyphenyl)propanoic acid (PubChem CID 70247709) has the molecular formula C24H27N5O6 and a molecular weight of 481.51 g/mol. Its IUPAC name is (3S)-3-[[2-[(4S)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(4-ethoxyphenyl)propanoic acid.
| Compound Name | (3S)-3-[[2-[(4S)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(4-ethoxyphenyl)propanoic acid |
|---|---|
| PubChem CID | 70247709 |
| Molecular Formula | C24H27N5O6 |
| Molecular Weight | 481.51 g/mol |
| Exact Mass | 481.20 |
| IUPAC Name | (3S)-3-[[2-[(4S)-4-(4-carbamimidoylphenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-(4-ethoxyphenyl)propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc([C@]2(C)NC(=O)N(CC(=O)N[C@@H](CC(=O)O)c3ccc(OCC)cc3)C2=O)cc1 |
| InChI | InChI=1S/C24H27N5O6/c1-3-35-17-10-6-14(7-11-17)18(12-20(31)32)27-19(30)13-29-22(33)24(2,28-23(29)34)16-8-4-15(5-9-16)21(25)26/h4-11,18H,3,12-13H2,1-2H3,(H3,25,26)(H,27,30)(H,28,34)(H,31,32)/t18-,24-/m0/s1 |
| InChIKey | ZUUCCXKPXFOSDM-UUOWRZLLSA-N |
| XLogP | 1.47 |
| TPSA | 174.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.51 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|