C26H31N5O5 — CID 10791332
ethyl 3-[[2-[4-(4-carbamimidoylphenyl)-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate (PubChem CID 10791332) has the molecular formula C26H31N5O5 and a molecular weight of 493.56 g/mol. Its IUPAC name is ethyl 3-[[2-[4-(4-carbamimidoylphenyl)-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate.
| Compound Name | ethyl 3-[[2-[4-(4-carbamimidoylphenyl)-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 10791332 |
| Molecular Formula | C26H31N5O5 |
| Molecular Weight | 493.56 g/mol |
| Exact Mass | 493.23 |
| IUPAC Name | ethyl 3-[[2-[4-(4-carbamimidoylphenyl)-3-ethyl-4-methyl-2,5-dioxoimidazolidin-1-yl]acetyl]amino]-3-phenylpropanoate |
| SMILES | [H]/N=C(\N)c1ccc(C2(C)C(=O)N(CC(=O)NC(CC(=O)OCC)c3ccccc3)C(=O)N2CC)cc1 |
| InChI | InChI=1S/C26H31N5O5/c1-4-31-25(35)30(24(34)26(31,3)19-13-11-18(12-14-19)23(27)28)16-21(32)29-20(15-22(33)36-5-2)17-9-7-6-8-10-17/h6-14,20H,4-5,15-16H2,1-3H3,(H3,27,28)(H,29,32) |
| InChIKey | SCAMAWCVWRAKKI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 145.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.56 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|